C23H17N2S+ — CID 170684585
11,14-dimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaene-19-thiol (PubChem CID 170684585) has the molecular formula C23H17N2S+ and a molecular weight of 353.47 g/mol. Its IUPAC name is 11,14-dimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaene-19-thiol.
| Compound Name | 11,14-dimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaene-19-thiol |
|---|---|
| PubChem CID | 170684585 |
| Molecular Formula | C23H17N2S+ |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 11,14-dimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaene-19-thiol |
| SMILES | Cc1ccc2c3ccccc3n3c4cc(S)cc5cc[n+](C)c(c1c23)c54 |
| InChI | InChI=1S/C23H16N2S/c1-13-7-8-17-16-5-3-4-6-18(16)25-19-12-15(26)11-14-9-10-24(2)23(21(14)19)20(13)22(17)25/h3-12H,1-2H3/p+1 |
| InChIKey | UZUSPFHDRCRGKP-UHFFFAOYSA-O |
| XLogP | 5.41 |
| TPSA | 8.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|