C24H23N2SSi+ — CID 170684928
(10,13-dimethyl-5-thia-1-aza-13-azoniahexacyclo[9.9.1.112,16.02,6.07,21.020,22]docosa-2(6),3,7(21),8,10,12,14,16,18,20(22)-decaen-18-yl)-trimethylsilane (PubChem CID 170684928) has the molecular formula C24H23N2SSi+ and a molecular weight of 399.62 g/mol. Its IUPAC name is (10,13-dimethyl-5-thia-1-aza-13-azoniahexacyclo[9.9.1.112,16.02,6.07,21.020,22]docosa-2(6),3,7(21),8,10,12,14,16,18,20(22)-decaen-18-yl)-trimethylsilane.
| Compound Name | (10,13-dimethyl-5-thia-1-aza-13-azoniahexacyclo[9.9.1.112,16.02,6.07,21.020,22]docosa-2(6),3,7(21),8,10,12,14,16,18,20(22)-decaen-18-yl)-trimethylsilane |
|---|---|
| PubChem CID | 170684928 |
| Molecular Formula | C24H23N2SSi+ |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | (10,13-dimethyl-5-thia-1-aza-13-azoniahexacyclo[9.9.1.112,16.02,6.07,21.020,22]docosa-2(6),3,7(21),8,10,12,14,16,18,20(22)-decaen-18-yl)-trimethylsilane |
| SMILES | Cc1ccc2c3sccc3n3c4cc([Si](C)(C)C)cc5cc[n+](C)c(c1c23)c54 |
| InChI | InChI=1S/C24H23N2SSi/c1-14-6-7-17-22-20(14)23-21-15(8-10-25(23)2)12-16(28(3,4)5)13-19(21)26(22)18-9-11-27-24(17)18/h6-13H,1-5H3/q+1 |
| InChIKey | BSAVUCKECQKKTH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|