C35H39N2+ — CID 166029376
19-(cyclopentylmethyl)-6-(2,2-dimethylpropyl)-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaene (PubChem CID 166029376) has the molecular formula C35H39N2+ and a molecular weight of 487.71 g/mol. Its IUPAC name is 19-(cyclopentylmethyl)-6-(2,2-dimethylpropyl)-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaene.
| Compound Name | 19-(cyclopentylmethyl)-6-(2,2-dimethylpropyl)-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaene |
|---|---|
| PubChem CID | 166029376 |
| Molecular Formula | C35H39N2+ |
| Molecular Weight | 487.71 g/mol |
| Exact Mass | 487.31 |
| IUPAC Name | 19-(cyclopentylmethyl)-6-(2,2-dimethylpropyl)-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaene |
| SMILES | Cc1cc2c3c(CC(C)(C)C)cccc3n3c4cc(CC5CCCC5)cc5cc[n+](C)c(c(c1C)c23)c54 |
| InChI | InChI=1S/C35H39N2/c1-21-16-27-31-26(20-35(3,4)5)12-9-13-28(31)37-29-19-24(17-23-10-7-8-11-23)18-25-14-15-36(6)34(32(25)29)30(22(21)2)33(27)37/h9,12-16,18-19,23H,7-8,10-11,17,20H2,1-6H3/q+1 |
| InChIKey | MPGUKNINQOMBJJ-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.71 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|