C37H40N3+ — CID 170235136
5,20-bis(2,2-dimethylpropyl)-14,17,24-trimethyl-1,12-diaza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2(7),3,5,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene (PubChem CID 170235136) has the molecular formula C37H40N3+ and a molecular weight of 526.75 g/mol. Its IUPAC name is 5,20-bis(2,2-dimethylpropyl)-14,17,24-trimethyl-1,12-diaza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2(7),3,5,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene.
| Compound Name | 5,20-bis(2,2-dimethylpropyl)-14,17,24-trimethyl-1,12-diaza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2(7),3,5,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene |
|---|---|
| PubChem CID | 170235136 |
| Molecular Formula | C37H40N3+ |
| Molecular Weight | 526.75 g/mol |
| Exact Mass | 526.32 |
| IUPAC Name | 5,20-bis(2,2-dimethylpropyl)-14,17,24-trimethyl-1,12-diaza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2(7),3,5,8(26),9,11(27),12,14,16(25),17,19,21,23-tridecaene |
| SMILES | Cc1c2cc(CC(C)(C)C)ccc2c(C)c2c1c1c3c(ccc4c5cc(CC(C)(C)C)ccc5n2c43)nc[n+]1C |
| InChI | InChI=1S/C37H40N3/c1-21-27-16-23(18-36(3,4)5)10-12-25(27)22(2)33-31(21)35-32-29(38-20-39(35)9)14-13-26-28-17-24(19-37(6,7)8)11-15-30(28)40(33)34(26)32/h10-17,20H,18-19H2,1-9H3/q+1 |
| InChIKey | AOZWKDPQYRLTET-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.75 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|