C31H30F3N2+ — CID 169015431
19-(2,2-dimethylpropyl)-3,5,6,9-tetramethyl-11-(trifluoromethyl)-1-aza-9-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12(23),13,15(22),16(21),17,19-undecaene (PubChem CID 169015431) has the molecular formula C31H30F3N2+ and a molecular weight of 487.59 g/mol. Its IUPAC name is 19-(2,2-dimethylpropyl)-3,5,6,9-tetramethyl-11-(trifluoromethyl)-1-aza-9-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12(23),13,15(22),16(21),17,19-undecaene.
| Compound Name | 19-(2,2-dimethylpropyl)-3,5,6,9-tetramethyl-11-(trifluoromethyl)-1-aza-9-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12(23),13,15(22),16(21),17,19-undecaene |
|---|---|
| PubChem CID | 169015431 |
| Molecular Formula | C31H30F3N2+ |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 19-(2,2-dimethylpropyl)-3,5,6,9-tetramethyl-11-(trifluoromethyl)-1-aza-9-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12(23),13,15(22),16(21),17,19-undecaene |
| SMILES | Cc1cc(C)c2c(c1C)c1c3c(ccc4c5ccc(CC(C)(C)C)cc5n2c43)c(C(F)(F)F)c[n+]1C |
| InChI | InChI=1S/C31H30F3N2/c1-16-12-17(2)27-25(18(16)3)29-26-22(23(15-35(29)7)31(32,33)34)11-10-21-20-9-8-19(14-30(4,5)6)13-24(20)36(27)28(21)26/h8-13,15H,14H2,1-7H3/q+1 |
| InChIKey | MBNLOKGCIBICTF-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|