C27H26FGeN2+ — CID 166030200
(9-fluoro-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8,10,12(22),13,15,17,19,21(23)-undecaen-19-yl)-trimethylgermane (PubChem CID 166030200) has the molecular formula C27H26FGeN2+ and a molecular weight of 470.13 g/mol. Its IUPAC name is (9-fluoro-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8,10,12(22),13,15,17,19,21(23)-undecaen-19-yl)-trimethylgermane.
| Compound Name | (9-fluoro-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8,10,12(22),13,15,17,19,21(23)-undecaen-19-yl)-trimethylgermane |
|---|---|
| PubChem CID | 166030200 |
| Molecular Formula | C27H26FGeN2+ |
| Molecular Weight | 470.13 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | (9-fluoro-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8,10,12(22),13,15,17,19,21(23)-undecaen-19-yl)-trimethylgermane |
| SMILES | Cc1c(F)c2c3ccccc3n3c4cc([Ge](C)(C)C)cc5cc[n+](C)c(c(c1C)c23)c54 |
| InChI | InChI=1S/C27H26FGeN2/c1-15-16(2)25(28)24-19-9-7-8-10-20(19)31-21-14-18(29(3,4)5)13-17-11-12-30(6)26(23(17)21)22(15)27(24)31/h7-14H,1-6H3/q+1 |
| InChIKey | FYQAUDAEMLZYKG-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.13 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|