C32H32FN2+ — CID 166029438
19-(4,4-dimethylcyclohexyl)-9-fluoro-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8,10,12(22),13,15,17,19,21(23)-undecaene (PubChem CID 166029438) has the molecular formula C32H32FN2+ and a molecular weight of 463.62 g/mol. Its IUPAC name is 19-(4,4-dimethylcyclohexyl)-9-fluoro-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8,10,12(22),13,15,17,19,21(23)-undecaene.
| Compound Name | 19-(4,4-dimethylcyclohexyl)-9-fluoro-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8,10,12(22),13,15,17,19,21(23)-undecaene |
|---|---|
| PubChem CID | 166029438 |
| Molecular Formula | C32H32FN2+ |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | 19-(4,4-dimethylcyclohexyl)-9-fluoro-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8,10,12(22),13,15,17,19,21(23)-undecaene |
| SMILES | Cc1c(F)c2c3ccccc3n3c4cc(C5CCC(C)(C)CC5)cc5cc[n+](C)c(c(c1C)c23)c54 |
| InChI | InChI=1S/C32H32FN2/c1-18-19(2)29(33)28-23-8-6-7-9-24(23)35-25-17-22(20-10-13-32(3,4)14-11-20)16-21-12-15-34(5)30(27(21)25)26(18)31(28)35/h6-9,12,15-17,20H,10-11,13-14H2,1-5H3/q+1 |
| InChIKey | AOVBHZFPEZQSFI-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|