C31H26GeN3+ — CID 169015346
14,17-dimethyl-9-trimethylgermyl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8,10,12,14,16,18,20,22,24,26-tridecaene-24-carbonitrile (PubChem CID 169015346) has the molecular formula C31H26GeN3+ and a molecular weight of 513.18 g/mol. Its IUPAC name is 14,17-dimethyl-9-trimethylgermyl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8,10,12,14,16,18,20,22,24,26-tridecaene-24-carbonitrile.
| Compound Name | 14,17-dimethyl-9-trimethylgermyl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8,10,12,14,16,18,20,22,24,26-tridecaene-24-carbonitrile |
|---|---|
| PubChem CID | 169015346 |
| Molecular Formula | C31H26GeN3+ |
| Molecular Weight | 513.18 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 14,17-dimethyl-9-trimethylgermyl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8,10,12,14,16,18,20,22,24,26-tridecaene-24-carbonitrile |
| SMILES | Cc1c2ccccc2c(C#N)c2c1c1c3c(cc[n+]1C)cc([Ge](C)(C)C)c1c4ccccc4n2c13 |
| InChI | InChI=1S/C31H26GeN3/c1-18-20-10-6-7-11-21(20)23(17-33)29-26(18)30-27-19(14-15-34(30)5)16-24(32(2,3)4)28-22-12-8-9-13-25(22)35(29)31(27)28/h6-16H,1-5H3/q+1 |
| InChIKey | UFLHGMJMJXFJDT-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 32.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.18 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|