C34H32IN2+ — CID 170232619
9-ethyl-24-(2-iodo-2-methylpropyl)-14,17,20-trimethyl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8,10,12,14,16(25),17,19,21,23,26-tridecaene (PubChem CID 170232619) has the molecular formula C34H32IN2+ and a molecular weight of 595.55 g/mol. Its IUPAC name is 9-ethyl-24-(2-iodo-2-methylpropyl)-14,17,20-trimethyl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8,10,12,14,16(25),17,19,21,23,26-tridecaene.
| Compound Name | 9-ethyl-24-(2-iodo-2-methylpropyl)-14,17,20-trimethyl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8,10,12,14,16(25),17,19,21,23,26-tridecaene |
|---|---|
| PubChem CID | 170232619 |
| Molecular Formula | C34H32IN2+ |
| Molecular Weight | 595.55 g/mol |
| Exact Mass | 595.16 |
| IUPAC Name | 9-ethyl-24-(2-iodo-2-methylpropyl)-14,17,20-trimethyl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8,10,12,14,16(25),17,19,21,23,26-tridecaene |
| SMILES | CCc1cc2cc[n+](C)c3c4c(C)c5cc(C)ccc5c(CC(C)(C)I)c4n4c5ccccc5c1c4c23 |
| InChI | InChI=1S/C34H32IN2/c1-7-21-17-22-14-15-36(6)32-28-20(3)25-16-19(2)12-13-23(25)26(18-34(4,5)35)31(28)37-27-11-9-8-10-24(27)29(21)33(37)30(22)32/h8-17H,7,18H2,1-6H3/q+1 |
| InChIKey | SIHDFMHTMOSIFZ-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.55 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|