C36H37N2+ — CID 166029564
4-tert-butyl-23-(2,2-dimethylpropyl)-15,18-dimethyl-1-aza-18-azoniaheptacyclo[14.9.1.117,21.02,7.08,26.09,14.025,27]heptacosa-2(7),3,5,8(26),9,11,13,15,17,19,21,23,25(27)-tridecaene (PubChem CID 166029564) has the molecular formula C36H37N2+ and a molecular weight of 497.71 g/mol. Its IUPAC name is 4-tert-butyl-23-(2,2-dimethylpropyl)-15,18-dimethyl-1-aza-18-azoniaheptacyclo[14.9.1.117,21.02,7.08,26.09,14.025,27]heptacosa-2(7),3,5,8(26),9,11,13,15,17,19,21,23,25(27)-tridecaene.
| Compound Name | 4-tert-butyl-23-(2,2-dimethylpropyl)-15,18-dimethyl-1-aza-18-azoniaheptacyclo[14.9.1.117,21.02,7.08,26.09,14.025,27]heptacosa-2(7),3,5,8(26),9,11,13,15,17,19,21,23,25(27)-tridecaene |
|---|---|
| PubChem CID | 166029564 |
| Molecular Formula | C36H37N2+ |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | 4-tert-butyl-23-(2,2-dimethylpropyl)-15,18-dimethyl-1-aza-18-azoniaheptacyclo[14.9.1.117,21.02,7.08,26.09,14.025,27]heptacosa-2(7),3,5,8(26),9,11,13,15,17,19,21,23,25(27)-tridecaene |
| SMILES | Cc1c2ccccc2c2c3ccc(C(C)(C)C)cc3n3c4cc(CC(C)(C)C)cc5cc[n+](C)c(c1c23)c54 |
| InChI | InChI=1S/C36H37N2/c1-21-25-11-9-10-12-26(25)32-27-14-13-24(36(5,6)7)19-28(27)38-29-18-22(20-35(2,3)4)17-23-15-16-37(8)33(31(23)29)30(21)34(32)38/h9-19H,20H2,1-8H3/q+1 |
| InChIKey | QXFWZBTVGUYLRU-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|