C39H43N2+ — CID 166030236
19-(1-adamantyl)-5-(2,2-dimethylpropyl)-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaene (PubChem CID 166030236) has the molecular formula C39H43N2+ and a molecular weight of 539.79 g/mol. Its IUPAC name is 19-(1-adamantyl)-5-(2,2-dimethylpropyl)-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaene.
| Compound Name | 19-(1-adamantyl)-5-(2,2-dimethylpropyl)-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaene |
|---|---|
| PubChem CID | 166030236 |
| Molecular Formula | C39H43N2+ |
| Molecular Weight | 539.79 g/mol |
| Exact Mass | 539.34 |
| IUPAC Name | 19-(1-adamantyl)-5-(2,2-dimethylpropyl)-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaene |
| SMILES | Cc1cc2c3cc(CC(C)(C)C)ccc3n3c4cc(C56CC7CC(CC(C7)C5)C6)cc5cc[n+](C)c(c(c1C)c23)c54 |
| InChI | InChI=1S/C39H43N2/c1-22-11-31-30-15-24(18-38(3,4)5)7-8-32(30)41-33-17-29(39-19-25-12-26(20-39)14-27(13-25)21-39)16-28-9-10-40(6)37(35(28)33)34(23(22)2)36(31)41/h7-11,15-17,25-27H,12-14,18-21H2,1-6H3/q+1 |
| InChIKey | SUMLDJQYABFIBG-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.79 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|