C34H30N3+ — CID 170684774
19-(1-adamantyl)-11,14-dimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaene-6-carbonitrile (PubChem CID 170684774) has the molecular formula C34H30N3+ and a molecular weight of 480.64 g/mol. Its IUPAC name is 19-(1-adamantyl)-11,14-dimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaene-6-carbonitrile.
| Compound Name | 19-(1-adamantyl)-11,14-dimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaene-6-carbonitrile |
|---|---|
| PubChem CID | 170684774 |
| Molecular Formula | C34H30N3+ |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 19-(1-adamantyl)-11,14-dimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaene-6-carbonitrile |
| SMILES | Cc1ccc2c3c(C#N)cccc3n3c4cc(C56CC7CC(CC(C7)C5)C6)cc5cc[n+](C)c(c1c23)c54 |
| InChI | InChI=1S/C34H30N3/c1-19-6-7-26-30-24(18-35)4-3-5-27(30)37-28-14-25(34-15-20-10-21(16-34)12-22(11-20)17-34)13-23-8-9-36(2)33(31(23)28)29(19)32(26)37/h3-9,13-14,20-22H,10-12,15-17H2,1-2H3/q+1 |
| InChIKey | YVTWHRWPFNQBDQ-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 32.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|