C25H21N2O+ — CID 166030288
3-methoxy-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaene (PubChem CID 166030288) has the molecular formula C25H21N2O+ and a molecular weight of 365.46 g/mol. Its IUPAC name is 3-methoxy-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaene.
| Compound Name | 3-methoxy-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaene |
|---|---|
| PubChem CID | 166030288 |
| Molecular Formula | C25H21N2O+ |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 3-methoxy-10,11,14-trimethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaene |
| SMILES | COc1cccc2c3cc(C)c(C)c4c3n(c3cccc5cc[n+](C)c4c53)c12 |
| InChI | InChI=1S/C25H21N2O/c1-14-13-18-17-8-6-10-20(28-4)23(17)27-19-9-5-7-16-11-12-26(3)25(22(16)19)21(15(14)2)24(18)27/h5-13H,1-4H3/q+1 |
| InChIKey | LBCDLXLDUAACRR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 17.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|