C26H22N3+ — CID 170236535
3,4,6,17-tetramethyl-9-phenyl-8,10-diaza-17-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2,4,6,9,11(19),12,14(18),15-nonaene (PubChem CID 170236535) has the molecular formula C26H22N3+ and a molecular weight of 376.48 g/mol. Its IUPAC name is 3,4,6,17-tetramethyl-9-phenyl-8,10-diaza-17-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2,4,6,9,11(19),12,14(18),15-nonaene.
| Compound Name | 3,4,6,17-tetramethyl-9-phenyl-8,10-diaza-17-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2,4,6,9,11(19),12,14(18),15-nonaene |
|---|---|
| PubChem CID | 170236535 |
| Molecular Formula | C26H22N3+ |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 3,4,6,17-tetramethyl-9-phenyl-8,10-diaza-17-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2,4,6,9,11(19),12,14(18),15-nonaene |
| SMILES | Cc1cc(C)c2c(c1C)c1c3c(ccc4nc(-c5ccccc5)n2c43)cc[n+]1C |
| InChI | InChI=1S/C26H22N3/c1-15-14-16(2)23-21(17(15)3)25-22-18(12-13-28(25)4)10-11-20-24(22)29(23)26(27-20)19-8-6-5-7-9-19/h5-14H,1-4H3/q+1 |
| InChIKey | MHQLLOFLMGAEPQ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|