C34H35N6+ — CID 166029807
19-(4,6-ditert-butyl-1,3,5-triazin-2-yl)-10,11,14-trimethyl-1,6-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaene (PubChem CID 166029807) has the molecular formula C34H35N6+ and a molecular weight of 527.70 g/mol. Its IUPAC name is 19-(4,6-ditert-butyl-1,3,5-triazin-2-yl)-10,11,14-trimethyl-1,6-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaene.
| Compound Name | 19-(4,6-ditert-butyl-1,3,5-triazin-2-yl)-10,11,14-trimethyl-1,6-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaene |
|---|---|
| PubChem CID | 166029807 |
| Molecular Formula | C34H35N6+ |
| Molecular Weight | 527.70 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | 19-(4,6-ditert-butyl-1,3,5-triazin-2-yl)-10,11,14-trimethyl-1,6-diaza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaene |
| SMILES | Cc1cc2c3ncccc3n3c4cc(-c5nc(C(C)(C)C)nc(C(C)(C)C)n5)cc5cc[n+](C)c(c(c1C)c23)c54 |
| InChI | InChI=1S/C34H35N6/c1-18-15-22-27-23(11-10-13-35-27)40-24-17-21(30-36-31(33(3,4)5)38-32(37-30)34(6,7)8)16-20-12-14-39(9)29(26(20)24)25(19(18)2)28(22)40/h10-17H,1-9H3/q+1 |
| InChIKey | KQVDXQBNUCPZRI-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 59.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.70 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|