C41H45N2+ — CID 155769642
2-tert-butyl-9-[4-[2,6-di(propan-2-yl)phenyl]-1-methylpyridin-1-ium-2-yl]-1-methyl-6-phenylcarbazole (PubChem CID 155769642) has the molecular formula C41H45N2+ and a molecular weight of 565.83 g/mol. Its IUPAC name is 2-tert-butyl-9-[4-[2,6-di(propan-2-yl)phenyl]-1-methylpyridin-1-ium-2-yl]-1-methyl-6-phenylcarbazole.
| Compound Name | 2-tert-butyl-9-[4-[2,6-di(propan-2-yl)phenyl]-1-methylpyridin-1-ium-2-yl]-1-methyl-6-phenylcarbazole |
|---|---|
| PubChem CID | 155769642 |
| Molecular Formula | C41H45N2+ |
| Molecular Weight | 565.83 g/mol |
| Exact Mass | 565.36 |
| IUPAC Name | 2-tert-butyl-9-[4-[2,6-di(propan-2-yl)phenyl]-1-methylpyridin-1-ium-2-yl]-1-methyl-6-phenylcarbazole |
| SMILES | Cc1c(C(C)(C)C)ccc2c3cc(-c4ccccc4)ccc3n(-c3cc(-c4c(C(C)C)cccc4C(C)C)cc[n+]3C)c12 |
| InChI | InChI=1S/C41H45N2/c1-26(2)32-16-13-17-33(27(3)4)39(32)31-22-23-42(9)38(25-31)43-37-21-18-30(29-14-11-10-12-15-29)24-35(37)34-19-20-36(41(6,7)8)28(5)40(34)43/h10-27H,1-9H3/q+1 |
| InChIKey | XEBQWHIYAPZTSD-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.83 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|