C49H48N3+ — CID 170240207
11,20-bis[2,6-di(propan-2-yl)phenyl]-15,16-diaza-17-azoniaheptacyclo[13.11.2.02,7.08,28.09,14.017,22.023,27]octacosa-1(27),2,4,6,8(28),9(14),10,12,17(22),18,20,23,25-tridecaene (PubChem CID 170240207) has the molecular formula C49H48N3+ and a molecular weight of 678.94 g/mol. Its IUPAC name is 11,20-bis[2,6-di(propan-2-yl)phenyl]-15,16-diaza-17-azoniaheptacyclo[13.11.2.02,7.08,28.09,14.017,22.023,27]octacosa-1(27),2,4,6,8(28),9(14),10,12,17(22),18,20,23,25-tridecaene.
| Compound Name | 11,20-bis[2,6-di(propan-2-yl)phenyl]-15,16-diaza-17-azoniaheptacyclo[13.11.2.02,7.08,28.09,14.017,22.023,27]octacosa-1(27),2,4,6,8(28),9(14),10,12,17(22),18,20,23,25-tridecaene |
|---|---|
| PubChem CID | 170240207 |
| Molecular Formula | C49H48N3+ |
| Molecular Weight | 678.94 g/mol |
| Exact Mass | 678.38 |
| IUPAC Name | 11,20-bis[2,6-di(propan-2-yl)phenyl]-15,16-diaza-17-azoniaheptacyclo[13.11.2.02,7.08,28.09,14.017,22.023,27]octacosa-1(27),2,4,6,8(28),9(14),10,12,17(22),18,20,23,25-tridecaene |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1ccc2c(c1)c1c3ccccc3c3cccc4c3c1n2[nH][n+]1ccc(-c2c(C(C)C)cccc2C(C)C)cc41 |
| InChI | InChI=1S/C49H48N3/c1-28(2)34-16-11-17-35(29(3)4)45(34)32-22-23-43-42(26-32)48-39-15-10-9-14-38(39)40-20-13-21-41-44-27-33(24-25-51(44)50-52(43)49(48)47(40)41)46-36(30(5)6)18-12-19-37(46)31(7)8/h9-31,50H,1-8H3/q+1 |
| InChIKey | IMALUPUMPFJXKK-UHFFFAOYSA-N |
| XLogP | 13.45 |
| TPSA | 24.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.94 |
| LogP ≤ 5 | 13.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|