C33H23N2SSe+ — CID 171458844
7-carbazol-9-yl-2-methyl-1-(3-methyl-1-benzoselenophen-2-yl)-[1]benzothiolo[3,2-c]pyridin-2-ium (PubChem CID 171458844) has the molecular formula C33H23N2SSe+ and a molecular weight of 558.59 g/mol. Its IUPAC name is 7-carbazol-9-yl-2-methyl-1-(3-methyl-1-benzoselenophen-2-yl)-[1]benzothiolo[3,2-c]pyridin-2-ium.
| Compound Name | 7-carbazol-9-yl-2-methyl-1-(3-methyl-1-benzoselenophen-2-yl)-[1]benzothiolo[3,2-c]pyridin-2-ium |
|---|---|
| PubChem CID | 171458844 |
| Molecular Formula | C33H23N2SSe+ |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 559.07 |
| IUPAC Name | 7-carbazol-9-yl-2-methyl-1-(3-methyl-1-benzoselenophen-2-yl)-[1]benzothiolo[3,2-c]pyridin-2-ium |
| SMILES | Cc1c(-c2c3c(cc[n+]2C)sc2cc(-n4c5ccccc5c5ccccc54)ccc23)[se]c2ccccc12 |
| InChI | InChI=1S/C33H23N2SSe/c1-20-22-9-5-8-14-30(22)37-33(20)32-31-25-16-15-21(19-29(25)36-28(31)17-18-34(32)2)35-26-12-6-3-10-23(26)24-11-4-7-13-27(24)35/h3-19H,1-2H3/q+1 |
| InChIKey | ZQIJALOCYZIQQP-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|