C34H33N2+ — CID 170232973
6-tert-butyl-14,17-dimethyl-24-propan-2-yl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8(26),9,11(27),12,14,16,18,20,22,24-tridecaene (PubChem CID 170232973) has the molecular formula C34H33N2+ and a molecular weight of 469.65 g/mol. Its IUPAC name is 6-tert-butyl-14,17-dimethyl-24-propan-2-yl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8(26),9,11(27),12,14,16,18,20,22,24-tridecaene.
| Compound Name | 6-tert-butyl-14,17-dimethyl-24-propan-2-yl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8(26),9,11(27),12,14,16,18,20,22,24-tridecaene |
|---|---|
| PubChem CID | 170232973 |
| Molecular Formula | C34H33N2+ |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 6-tert-butyl-14,17-dimethyl-24-propan-2-yl-1-aza-14-azoniaheptacyclo[13.10.2.02,7.08,26.011,27.016,25.018,23]heptacosa-2,4,6,8(26),9,11(27),12,14,16,18,20,22,24-tridecaene |
| SMILES | Cc1c2ccccc2c(C(C)C)c2c1c1c3c(ccc4c5c(C(C)(C)C)cccc5n2c43)cc[n+]1C |
| InChI | InChI=1S/C34H33N2/c1-19(2)27-23-12-9-8-11-22(23)20(3)28-32-29-21(17-18-35(32)7)15-16-24-30-25(34(4,5)6)13-10-14-26(30)36(31(24)29)33(27)28/h8-19H,1-7H3/q+1 |
| InChIKey | WJDFHJTXWNBCNJ-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|