C19H16IN2+ — CID 147033622
9-(3-iodo-2-methylphenyl)-1-methylpyrido[2,3-b]indol-1-ium (PubChem CID 147033622) has the molecular formula C19H16IN2+ and a molecular weight of 399.26 g/mol. Its IUPAC name is 9-(3-iodo-2-methylphenyl)-1-methylpyrido[2,3-b]indol-1-ium.
| Compound Name | 9-(3-iodo-2-methylphenyl)-1-methylpyrido[2,3-b]indol-1-ium |
|---|---|
| PubChem CID | 147033622 |
| Molecular Formula | C19H16IN2+ |
| Molecular Weight | 399.26 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 9-(3-iodo-2-methylphenyl)-1-methylpyrido[2,3-b]indol-1-ium |
| SMILES | Cc1c(I)cccc1-n1c2ccccc2c2ccc[n+](C)c21 |
| InChI | InChI=1S/C19H16IN2/c1-13-16(20)9-5-11-17(13)22-18-10-4-3-7-14(18)15-8-6-12-21(2)19(15)22/h3-12H,1-2H3/q+1 |
| InChIKey | OSJXEYNGPXRAIL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.26 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|