C25H23N3O+2 — CID 177263706
1-methyl-9-[2-methyl-3-(1-methylpyridin-1-ium-2-yl)oxyphenyl]pyrido[2,3-b]indol-1-ium (PubChem CID 177263706) has the molecular formula C25H23N3O+2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 1-methyl-9-[2-methyl-3-(1-methylpyridin-1-ium-2-yl)oxyphenyl]pyrido[2,3-b]indol-1-ium.
| Compound Name | 1-methyl-9-[2-methyl-3-(1-methylpyridin-1-ium-2-yl)oxyphenyl]pyrido[2,3-b]indol-1-ium |
|---|---|
| PubChem CID | 177263706 |
| Molecular Formula | C25H23N3O+2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 1-methyl-9-[2-methyl-3-(1-methylpyridin-1-ium-2-yl)oxyphenyl]pyrido[2,3-b]indol-1-ium |
| SMILES | Cc1c(Oc2cccc[n+]2C)cccc1-n1c2ccccc2c2ccc[n+](C)c21 |
| InChI | InChI=1S/C25H23N3O/c1-18-21(13-8-14-23(18)29-24-15-6-7-16-26(24)2)28-22-12-5-4-10-19(22)20-11-9-17-27(3)25(20)28/h4-17H,1-3H3/q+2 |
| InChIKey | ASWRFAHINWACPP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 21.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|