C36H41N2+ — CID 123982925
9-(2,6-dimethylphenyl)-4-(2,2-dimethylpropyl)-12,15-diethyl-8-aza-11-azoniahexacyclo[9.8.2.02,7.08,21.012,15.016,20]henicosa-1(20),2(7),3,5,9,11(21),16,18-octaene (PubChem CID 123982925) has the molecular formula C36H41N2+ and a molecular weight of 501.74 g/mol. Its IUPAC name is 9-(2,6-dimethylphenyl)-4-(2,2-dimethylpropyl)-12,15-diethyl-8-aza-11-azoniahexacyclo[9.8.2.02,7.08,21.012,15.016,20]henicosa-1(20),2(7),3,5,9,11(21),16,18-octaene.
| Compound Name | 9-(2,6-dimethylphenyl)-4-(2,2-dimethylpropyl)-12,15-diethyl-8-aza-11-azoniahexacyclo[9.8.2.02,7.08,21.012,15.016,20]henicosa-1(20),2(7),3,5,9,11(21),16,18-octaene |
|---|---|
| PubChem CID | 123982925 |
| Molecular Formula | C36H41N2+ |
| Molecular Weight | 501.74 g/mol |
| Exact Mass | 501.33 |
| IUPAC Name | 9-(2,6-dimethylphenyl)-4-(2,2-dimethylpropyl)-12,15-diethyl-8-aza-11-azoniahexacyclo[9.8.2.02,7.08,21.012,15.016,20]henicosa-1(20),2(7),3,5,9,11(21),16,18-octaene |
| SMILES | CCC12CCC1(CC)[n+]1cc(-c3c(C)cccc3C)n3c4ccc(CC(C)(C)C)cc4c4cccc2c4c31 |
| InChI | InChI=1S/C36H41N2/c1-8-35-18-19-36(35,9-2)37-22-30(31-23(3)12-10-13-24(31)4)38-29-17-16-25(21-34(5,6)7)20-27(29)26-14-11-15-28(35)32(26)33(37)38/h10-17,20,22H,8-9,18-19,21H2,1-7H3/q+1 |
| InChIKey | WYXAKAHSPHRZKW-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.74 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|