C30H39N2+ — CID 123947472
4-(2,2-dimethylpropyl)-12,15-diethyl-10,11-dimethyl-8-aza-11-azoniahexacyclo[9.8.2.02,7.08,21.012,15.016,20]henicosa-1(20),2(7),3,5,9,16,18-heptaene (PubChem CID 123947472) has the molecular formula C30H39N2+ and a molecular weight of 427.66 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-12,15-diethyl-10,11-dimethyl-8-aza-11-azoniahexacyclo[9.8.2.02,7.08,21.012,15.016,20]henicosa-1(20),2(7),3,5,9,16,18-heptaene.
| Compound Name | 4-(2,2-dimethylpropyl)-12,15-diethyl-10,11-dimethyl-8-aza-11-azoniahexacyclo[9.8.2.02,7.08,21.012,15.016,20]henicosa-1(20),2(7),3,5,9,16,18-heptaene |
|---|---|
| PubChem CID | 123947472 |
| Molecular Formula | C30H39N2+ |
| Molecular Weight | 427.66 g/mol |
| Exact Mass | 427.31 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-12,15-diethyl-10,11-dimethyl-8-aza-11-azoniahexacyclo[9.8.2.02,7.08,21.012,15.016,20]henicosa-1(20),2(7),3,5,9,16,18-heptaene |
| SMILES | CCC12CCC1(CC)[N+]1(C)C(C)=CN3c4ccc(CC(C)(C)C)cc4-c4cccc2c4C31 |
| InChI | InChI=1S/C30H39N2/c1-8-29-15-16-30(29,9-2)32(7)20(3)19-31-25-14-13-21(18-28(4,5)6)17-23(25)22-11-10-12-24(29)26(22)27(31)32/h10-14,17,19,27H,8-9,15-16,18H2,1-7H3/q+1 |
| InChIKey | UTEKFNGNEVKBNJ-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.66 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|