C30H30 — CID 91591748
2-[6-(2,2-dimethylpropyl)naphthalen-2-yl]-9,9-dimethylfluorene (PubChem CID 91591748) has the molecular formula C30H30 and a molecular weight of 390.57 g/mol. Its IUPAC name is 2-[6-(2,2-dimethylpropyl)naphthalen-2-yl]-9,9-dimethylfluorene.
| Compound Name | 2-[6-(2,2-dimethylpropyl)naphthalen-2-yl]-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 91591748 |
| Molecular Formula | C30H30 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 2-[6-(2,2-dimethylpropyl)naphthalen-2-yl]-9,9-dimethylfluorene |
| SMILES | CC(C)(C)Cc1ccc2cc(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)ccc2c1 |
| InChI | InChI=1S/C30H30/c1-29(2,3)19-20-10-11-22-17-23(13-12-21(22)16-20)24-14-15-26-25-8-6-7-9-27(25)30(4,5)28(26)18-24/h6-18H,19H2,1-5H3 |
| InChIKey | ZNNWGTJYPGQKKY-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |