C28H27N2+ — CID 91231843
14,14-diethyl-3,18-dimethyl-13-methylidene-15-aza-1-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-1(22),2,4,6,8(23),9,11,16(21),17,19-decaene (PubChem CID 91231843) has the molecular formula C28H27N2+ and a molecular weight of 391.54 g/mol. Its IUPAC name is 14,14-diethyl-3,18-dimethyl-13-methylidene-15-aza-1-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-1(22),2,4,6,8(23),9,11,16(21),17,19-decaene.
| Compound Name | 14,14-diethyl-3,18-dimethyl-13-methylidene-15-aza-1-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-1(22),2,4,6,8(23),9,11,16(21),17,19-decaene |
|---|---|
| PubChem CID | 91231843 |
| Molecular Formula | C28H27N2+ |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | 14,14-diethyl-3,18-dimethyl-13-methylidene-15-aza-1-azoniahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-1(22),2,4,6,8(23),9,11,16(21),17,19-decaene |
| SMILES | C=C1c2cccc3c4cccc(C)c4[n+]4c5ccc(C)cc5n(c4c23)C1(CC)CC |
| InChI | InChI=1S/C28H27N2/c1-6-28(7-2)19(5)20-11-9-12-21-22-13-8-10-18(4)26(22)29-23-15-14-17(3)16-24(23)30(28)27(29)25(20)21/h8-16H,5-7H2,1-4H3/q+1 |
| InChIKey | YWQBJYYIKNTBRW-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 9.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|