C36H33ClN2O6 — CID 164986153
2-(3-chloro-4-ethyl-6-methyl-9-oxoacridin-10-yl)acetic acid;2-(5-ethyl-3-methyl-9-oxoacridin-10-yl)acetic acid (PubChem CID 164986153) has the molecular formula C36H33ClN2O6 and a molecular weight of 625.12 g/mol. Its IUPAC name is 2-(3-chloro-4-ethyl-6-methyl-9-oxoacridin-10-yl)acetic acid;2-(5-ethyl-3-methyl-9-oxoacridin-10-yl)acetic acid.
| Compound Name | 2-(3-chloro-4-ethyl-6-methyl-9-oxoacridin-10-yl)acetic acid;2-(5-ethyl-3-methyl-9-oxoacridin-10-yl)acetic acid |
|---|---|
| PubChem CID | 164986153 |
| Molecular Formula | C36H33ClN2O6 |
| Molecular Weight | 625.12 g/mol |
| Exact Mass | 624.20 |
| IUPAC Name | 2-(3-chloro-4-ethyl-6-methyl-9-oxoacridin-10-yl)acetic acid;2-(5-ethyl-3-methyl-9-oxoacridin-10-yl)acetic acid |
| SMILES | CCc1c(Cl)ccc2c(=O)c3ccc(C)cc3n(CC(=O)O)c12.CCc1cccc2c(=O)c3ccc(C)cc3n(CC(=O)O)c12 |
| InChI | InChI=1S/C18H16ClNO3.C18H17NO3/c1-3-11-14(19)7-6-13-17(11)20(9-16(21)22)15-8-10(2)4-5-12(15)18(13)23;1-3-12-5-4-6-14-17(12)19(10-16(20)21)15-9-11(2)7-8-13(15)18(14)22/h4-8H,3,9H2,1-2H3,(H,21,22);4-9H,3,10H2,1-2H3,(H,20,21) |
| InChIKey | GEMDATRAUFOKIL-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.12 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|