C20H15Cl2NO3 — CID 138658347
2-[3,4-dichloro-6-(cyclopenten-1-yl)-9-oxoacridin-10-yl]acetic acid (PubChem CID 138658347) has the molecular formula C20H15Cl2NO3 and a molecular weight of 388.25 g/mol. Its IUPAC name is 2-[3,4-dichloro-6-(cyclopenten-1-yl)-9-oxoacridin-10-yl]acetic acid.
| Compound Name | 2-[3,4-dichloro-6-(cyclopenten-1-yl)-9-oxoacridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 138658347 |
| Molecular Formula | C20H15Cl2NO3 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 2-[3,4-dichloro-6-(cyclopenten-1-yl)-9-oxoacridin-10-yl]acetic acid |
| SMILES | O=C(O)Cn1c2cc(C3=CCCC3)ccc2c(=O)c2ccc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C20H15Cl2NO3/c21-15-8-7-14-19(18(15)22)23(10-17(24)25)16-9-12(11-3-1-2-4-11)5-6-13(16)20(14)26/h3,5-9H,1-2,4,10H2,(H,24,25) |
| InChIKey | YMABGWHZUJHJSC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|