C15H8BrCl2NO3 — CID 138658101
2-(2-bromo-5,6-dichloro-9-oxoacridin-10-yl)acetic acid (PubChem CID 138658101) has the molecular formula C15H8BrCl2NO3 and a molecular weight of 401.04 g/mol. Its IUPAC name is 2-(2-bromo-5,6-dichloro-9-oxoacridin-10-yl)acetic acid.
| Compound Name | 2-(2-bromo-5,6-dichloro-9-oxoacridin-10-yl)acetic acid |
|---|---|
| PubChem CID | 138658101 |
| Molecular Formula | C15H8BrCl2NO3 |
| Molecular Weight | 401.04 g/mol |
| Exact Mass | 398.91 |
| IUPAC Name | 2-(2-bromo-5,6-dichloro-9-oxoacridin-10-yl)acetic acid |
| SMILES | O=C(O)Cn1c2ccc(Br)cc2c(=O)c2ccc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C15H8BrCl2NO3/c16-7-1-4-11-9(5-7)15(22)8-2-3-10(17)13(18)14(8)19(11)6-12(20)21/h1-5H,6H2,(H,20,21) |
| InChIKey | MAHVWPFIFXVPOO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.04 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|