C23H21Cl2NO3 — CID 138657877
2-[5,6-dichloro-2-(5,5-dimethylcyclohexen-1-yl)-9-oxoacridin-10-yl]acetic acid (PubChem CID 138657877) has the molecular formula C23H21Cl2NO3 and a molecular weight of 430.33 g/mol. Its IUPAC name is 2-[5,6-dichloro-2-(5,5-dimethylcyclohexen-1-yl)-9-oxoacridin-10-yl]acetic acid.
| Compound Name | 2-[5,6-dichloro-2-(5,5-dimethylcyclohexen-1-yl)-9-oxoacridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 138657877 |
| Molecular Formula | C23H21Cl2NO3 |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 2-[5,6-dichloro-2-(5,5-dimethylcyclohexen-1-yl)-9-oxoacridin-10-yl]acetic acid |
| SMILES | CC1(C)CCC=C(c2ccc3c(c2)c(=O)c2ccc(Cl)c(Cl)c2n3CC(=O)O)C1 |
| InChI | InChI=1S/C23H21Cl2NO3/c1-23(2)9-3-4-14(11-23)13-5-8-18-16(10-13)22(29)15-6-7-17(24)20(25)21(15)26(18)12-19(27)28/h4-8,10H,3,9,11-12H2,1-2H3,(H,27,28) |
| InChIKey | OBMBPARIGOIHJP-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|