C19H20N2O3 — CID 138657985
2-[4-(dimethylamino)-3,6-dimethyl-9-oxoacridin-10-yl]acetic acid (PubChem CID 138657985) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-3,6-dimethyl-9-oxoacridin-10-yl]acetic acid.
| Compound Name | 2-[4-(dimethylamino)-3,6-dimethyl-9-oxoacridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 138657985 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-[4-(dimethylamino)-3,6-dimethyl-9-oxoacridin-10-yl]acetic acid |
| SMILES | Cc1ccc2c(=O)c3ccc(C)c(N(C)C)c3n(CC(=O)O)c2c1 |
| InChI | InChI=1S/C19H20N2O3/c1-11-5-7-13-15(9-11)21(10-16(22)23)18-14(19(13)24)8-6-12(2)17(18)20(3)4/h5-9H,10H2,1-4H3,(H,22,23) |
| InChIKey | KKTNTESLELUCCQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|