C26H25F2N3O3 — CID 155723739
ethyl 2-[6-(2,6-difluoroanilino)-4-(dimethylamino)-3-methyl-9-oxoacridin-10-yl]acetate (PubChem CID 155723739) has the molecular formula C26H25F2N3O3 and a molecular weight of 465.50 g/mol. Its IUPAC name is ethyl 2-[6-(2,6-difluoroanilino)-4-(dimethylamino)-3-methyl-9-oxoacridin-10-yl]acetate.
| Compound Name | ethyl 2-[6-(2,6-difluoroanilino)-4-(dimethylamino)-3-methyl-9-oxoacridin-10-yl]acetate |
|---|---|
| PubChem CID | 155723739 |
| Molecular Formula | C26H25F2N3O3 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | ethyl 2-[6-(2,6-difluoroanilino)-4-(dimethylamino)-3-methyl-9-oxoacridin-10-yl]acetate |
| SMILES | CCOC(=O)Cn1c2cc(Nc3c(F)cccc3F)ccc2c(=O)c2ccc(C)c(N(C)C)c21 |
| InChI | InChI=1S/C26H25F2N3O3/c1-5-34-22(32)14-31-21-13-16(29-23-19(27)7-6-8-20(23)28)10-12-17(21)26(33)18-11-9-15(2)24(25(18)31)30(3)4/h6-13,29H,5,14H2,1-4H3 |
| InChIKey | AWXKUMPGCJKYLN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|