C24H25N2+ — CID 123193472
12,12-diethyl-10-methyl-14-methylidene-11-aza-8-azoniapentacyclo[9.7.2.02,7.08,20.015,19]icosa-1(19),2,4,6,8(20),9,15,17-octaene (PubChem CID 123193472) has the molecular formula C24H25N2+ and a molecular weight of 341.48 g/mol. Its IUPAC name is 12,12-diethyl-10-methyl-14-methylidene-11-aza-8-azoniapentacyclo[9.7.2.02,7.08,20.015,19]icosa-1(19),2,4,6,8(20),9,15,17-octaene.
| Compound Name | 12,12-diethyl-10-methyl-14-methylidene-11-aza-8-azoniapentacyclo[9.7.2.02,7.08,20.015,19]icosa-1(19),2,4,6,8(20),9,15,17-octaene |
|---|---|
| PubChem CID | 123193472 |
| Molecular Formula | C24H25N2+ |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 12,12-diethyl-10-methyl-14-methylidene-11-aza-8-azoniapentacyclo[9.7.2.02,7.08,20.015,19]icosa-1(19),2,4,6,8(20),9,15,17-octaene |
| SMILES | C=C1CC(CC)(CC)n2c(C)c[n+]3c4ccccc4c4cccc1c4c23 |
| InChI | InChI=1S/C24H25N2/c1-5-24(6-2)14-16(3)18-11-9-12-20-19-10-7-8-13-21(19)25-15-17(4)26(24)23(25)22(18)20/h7-13,15H,3,5-6,14H2,1-2,4H3/q+1 |
| InChIKey | XPWVREQFESTNNC-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 9.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|