C18H21N2+ — CID 91288858
2,2-diethyl-9-methyl-11-aza-1-azoniatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),4(15),5,7,9,12-hexaene (PubChem CID 91288858) has the molecular formula C18H21N2+ and a molecular weight of 265.38 g/mol. Its IUPAC name is 2,2-diethyl-9-methyl-11-aza-1-azoniatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),4(15),5,7,9,12-hexaene.
| Compound Name | 2,2-diethyl-9-methyl-11-aza-1-azoniatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),4(15),5,7,9,12-hexaene |
|---|---|
| PubChem CID | 91288858 |
| Molecular Formula | C18H21N2+ |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 2,2-diethyl-9-methyl-11-aza-1-azoniatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),4(15),5,7,9,12-hexaene |
| SMILES | CCC1(CC)Cc2cccc3c(C)cn4cc[n+]1c4c23 |
| InChI | InChI=1S/C18H21N2/c1-4-18(5-2)11-14-7-6-8-15-13(3)12-19-9-10-20(18)17(19)16(14)15/h6-10,12H,4-5,11H2,1-3H3/q+1 |
| InChIKey | ILRXRMPVXPKQKR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|