C28H33N2+ — CID 161298586
1-[2,6-di(propan-2-yl)phenyl]-3,5-dimethyl-2-(2-methylphenyl)benzimidazol-1-ium (PubChem CID 161298586) has the molecular formula C28H33N2+ and a molecular weight of 397.59 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3,5-dimethyl-2-(2-methylphenyl)benzimidazol-1-ium.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3,5-dimethyl-2-(2-methylphenyl)benzimidazol-1-ium |
|---|---|
| PubChem CID | 161298586 |
| Molecular Formula | C28H33N2+ |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3,5-dimethyl-2-(2-methylphenyl)benzimidazol-1-ium |
| SMILES | Cc1ccc2c(c1)n(C)c(-c1ccccc1C)[n+]2-c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C28H33N2/c1-18(2)22-13-10-14-23(19(3)4)27(22)30-25-16-15-20(5)17-26(25)29(7)28(30)24-12-9-8-11-21(24)6/h8-19H,1-7H3/q+1 |
| InChIKey | BKLUKSMPTQARGI-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|