C33H28N3+ — CID 140847323
1-(2,6-diphenylphenyl)-3,5-dimethyl-2-(4-methyl-3-pyridinyl)benzimidazol-1-ium (PubChem CID 140847323) has the molecular formula C33H28N3+ and a molecular weight of 466.61 g/mol. Its IUPAC name is 1-(2,6-diphenylphenyl)-3,5-dimethyl-2-(4-methyl-3-pyridinyl)benzimidazol-1-ium.
| Compound Name | 1-(2,6-diphenylphenyl)-3,5-dimethyl-2-(4-methyl-3-pyridinyl)benzimidazol-1-ium |
|---|---|
| PubChem CID | 140847323 |
| Molecular Formula | C33H28N3+ |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 1-(2,6-diphenylphenyl)-3,5-dimethyl-2-(4-methyl-3-pyridinyl)benzimidazol-1-ium |
| SMILES | Cc1ccc2c(c1)n(C)c(-c1cnccc1C)[n+]2-c1c(-c2ccccc2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C33H28N3/c1-23-17-18-30-31(21-23)35(3)33(29-22-34-20-19-24(29)2)36(30)32-27(25-11-6-4-7-12-25)15-10-16-28(32)26-13-8-5-9-14-26/h4-22H,1-3H3/q+1 |
| InChIKey | RCCSNAWUWKHYQH-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|