C34H44O3 — CID 145179128
2-cyclohexyl-4-[(5-heptan-3-yl-4-hydroxy-2-methylphenyl)-(2-hydroxyphenyl)methyl]-5-methylphenol (PubChem CID 145179128) has the molecular formula C34H44O3 and a molecular weight of 500.72 g/mol. Its IUPAC name is 2-cyclohexyl-4-[(5-heptan-3-yl-4-hydroxy-2-methylphenyl)-(2-hydroxyphenyl)methyl]-5-methylphenol.
| Compound Name | 2-cyclohexyl-4-[(5-heptan-3-yl-4-hydroxy-2-methylphenyl)-(2-hydroxyphenyl)methyl]-5-methylphenol |
|---|---|
| PubChem CID | 145179128 |
| Molecular Formula | C34H44O3 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | 2-cyclohexyl-4-[(5-heptan-3-yl-4-hydroxy-2-methylphenyl)-(2-hydroxyphenyl)methyl]-5-methylphenol |
| SMILES | CCCCC(CC)c1cc(C(c2cc(C3CCCCC3)c(O)cc2C)c2ccccc2O)c(C)cc1O |
| InChI | InChI=1S/C34H44O3/c1-5-7-13-24(6-2)29-20-27(22(3)18-32(29)36)34(26-16-11-12-17-31(26)35)28-21-30(33(37)19-23(28)4)25-14-9-8-10-15-25/h11-12,16-21,24-25,34-37H,5-10,13-15H2,1-4H3 |
| InChIKey | WBNWTUIOKVBXEV-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|