C35H44O3 — CID 139696623
2-cyclohexyl-4-[(5-cyclohexyl-4-hydroxy-2-methylphenyl)-(4-ethoxyphenyl)methyl]-5-methylphenol (PubChem CID 139696623) has the molecular formula C35H44O3 and a molecular weight of 512.73 g/mol. Its IUPAC name is 2-cyclohexyl-4-[(5-cyclohexyl-4-hydroxy-2-methylphenyl)-(4-ethoxyphenyl)methyl]-5-methylphenol.
| Compound Name | 2-cyclohexyl-4-[(5-cyclohexyl-4-hydroxy-2-methylphenyl)-(4-ethoxyphenyl)methyl]-5-methylphenol |
|---|---|
| PubChem CID | 139696623 |
| Molecular Formula | C35H44O3 |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.33 |
| IUPAC Name | 2-cyclohexyl-4-[(5-cyclohexyl-4-hydroxy-2-methylphenyl)-(4-ethoxyphenyl)methyl]-5-methylphenol |
| SMILES | CCOc1ccc(C(c2cc(C3CCCCC3)c(O)cc2C)c2cc(C3CCCCC3)c(O)cc2C)cc1 |
| InChI | InChI=1S/C35H44O3/c1-4-38-28-17-15-27(16-18-28)35(29-21-31(33(36)19-23(29)2)25-11-7-5-8-12-25)30-22-32(34(37)20-24(30)3)26-13-9-6-10-14-26/h15-22,25-26,35-37H,4-14H2,1-3H3 |
| InChIKey | VZFKHFZFSBIDKU-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|