C31H46O2 — CID 142247556
2,4-dicyclohexyl-5-methylphenol;2,4,5-triethylphenol (PubChem CID 142247556) has the molecular formula C31H46O2 and a molecular weight of 450.71 g/mol. Its IUPAC name is 2,4-dicyclohexyl-5-methylphenol;2,4,5-triethylphenol.
| Compound Name | 2,4-dicyclohexyl-5-methylphenol;2,4,5-triethylphenol |
|---|---|
| PubChem CID | 142247556 |
| Molecular Formula | C31H46O2 |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 450.35 |
| IUPAC Name | 2,4-dicyclohexyl-5-methylphenol;2,4,5-triethylphenol |
| SMILES | CCc1cc(CC)c(CC)cc1O.Cc1cc(O)c(C2CCCCC2)cc1C1CCCCC1 |
| InChI | InChI=1S/C19H28O.C12H18O/c1-14-12-19(20)18(16-10-6-3-7-11-16)13-17(14)15-8-4-2-5-9-15;1-4-9-7-11(6-3)12(13)8-10(9)5-2/h12-13,15-16,20H,2-11H2,1H3;7-8,13H,4-6H2,1-3H3 |
| InChIKey | JQOJOBIGKORMPC-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |