C22H28O — CID 67723850
2-cyclohexyl-5-methyl-4-(1-phenylpropan-2-yl)phenol (PubChem CID 67723850) has the molecular formula C22H28O and a molecular weight of 308.46 g/mol. Its IUPAC name is 2-cyclohexyl-5-methyl-4-(1-phenylpropan-2-yl)phenol.
| Compound Name | 2-cyclohexyl-5-methyl-4-(1-phenylpropan-2-yl)phenol |
|---|---|
| PubChem CID | 67723850 |
| Molecular Formula | C22H28O |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 2-cyclohexyl-5-methyl-4-(1-phenylpropan-2-yl)phenol |
| SMILES | Cc1cc(O)c(C2CCCCC2)cc1C(C)Cc1ccccc1 |
| InChI | InChI=1S/C22H28O/c1-16(13-18-9-5-3-6-10-18)20-15-21(22(23)14-17(20)2)19-11-7-4-8-12-19/h3,5-6,9-10,14-16,19,23H,4,7-8,11-13H2,1-2H3 |
| InChIKey | VIYQFTURNCPILT-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |