C58H68O8 — CID 157123763
4-[bis(5-cyclohexyl-4-hydroxy-2-methylphenyl)methyl]benzene-1,2-diol;4-[bis(4-hydroxy-2,3,5-trimethylphenyl)methyl]benzene-1,2-diol (PubChem CID 157123763) has the molecular formula C58H68O8 and a molecular weight of 893.17 g/mol. Its IUPAC name is 4-[bis(5-cyclohexyl-4-hydroxy-2-methylphenyl)methyl]benzene-1,2-diol;4-[bis(4-hydroxy-2,3,5-trimethylphenyl)methyl]benzene-1,2-diol.
| Compound Name | 4-[bis(5-cyclohexyl-4-hydroxy-2-methylphenyl)methyl]benzene-1,2-diol;4-[bis(4-hydroxy-2,3,5-trimethylphenyl)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 157123763 |
| Molecular Formula | C58H68O8 |
| Molecular Weight | 893.17 g/mol |
| Exact Mass | 892.49 |
| IUPAC Name | 4-[bis(5-cyclohexyl-4-hydroxy-2-methylphenyl)methyl]benzene-1,2-diol;4-[bis(4-hydroxy-2,3,5-trimethylphenyl)methyl]benzene-1,2-diol |
| SMILES | Cc1cc(C(c2ccc(O)c(O)c2)c2cc(C)c(O)c(C)c2C)c(C)c(C)c1O.Cc1cc(O)c(C2CCCCC2)cc1C(c1ccc(O)c(O)c1)c1cc(C2CCCCC2)c(O)cc1C |
| InChI | InChI=1S/C33H40O4.C25H28O4/c1-20-15-30(35)27(22-9-5-3-6-10-22)18-25(20)33(24-13-14-29(34)32(37)17-24)26-19-28(31(36)16-21(26)2)23-11-7-4-8-12-23;1-12-9-19(14(3)16(5)24(12)28)23(18-7-8-21(26)22(27)11-18)20-10-13(2)25(29)17(6)15(20)4/h13-19,22-23,33-37H,3-12H2,1-2H3;7-11,23,26-29H,1-6H3 |
| InChIKey | AIGXHFZJXMEAIN-UHFFFAOYSA-N |
| XLogP | 13.94 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.17 |
| LogP ≤ 5 | 13.94 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|