C47H37N3 — CID 163918650
2,4-diphenyl-6-[3-(5,5,6,6-tetramethylpicen-2-yl)phenyl]-1,3,5-triazine (PubChem CID 163918650) has the molecular formula C47H37N3 and a molecular weight of 643.83 g/mol. Its IUPAC name is 2,4-diphenyl-6-[3-(5,5,6,6-tetramethylpicen-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[3-(5,5,6,6-tetramethylpicen-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 163918650 |
| Molecular Formula | C47H37N3 |
| Molecular Weight | 643.83 g/mol |
| Exact Mass | 643.30 |
| IUPAC Name | 2,4-diphenyl-6-[3-(5,5,6,6-tetramethylpicen-2-yl)phenyl]-1,3,5-triazine |
| SMILES | CC1(C)c2ccc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)cc2-c2ccc3c(ccc4ccccc43)c2C1(C)C |
| InChI | InChI=1S/C47H37N3/c1-46(2)41-27-23-34(29-40(41)39-26-25-37-36-21-12-11-14-30(36)22-24-38(37)42(39)47(46,3)4)33-19-13-20-35(28-33)45-49-43(31-15-7-5-8-16-31)48-44(50-45)32-17-9-6-10-18-32/h5-29H,1-4H3 |
| InChIKey | KNCISPJBTFMPAP-UHFFFAOYSA-N |
| XLogP | 12.08 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.83 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|