C41H33N3 — CID 163822142
2-phenanthren-2-yl-4-phenyl-6-(9,9,10,10-tetramethylphenanthren-1-yl)-1,3,5-triazine (PubChem CID 163822142) has the molecular formula C41H33N3 and a molecular weight of 567.74 g/mol. Its IUPAC name is 2-phenanthren-2-yl-4-phenyl-6-(9,9,10,10-tetramethylphenanthren-1-yl)-1,3,5-triazine.
| Compound Name | 2-phenanthren-2-yl-4-phenyl-6-(9,9,10,10-tetramethylphenanthren-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 163822142 |
| Molecular Formula | C41H33N3 |
| Molecular Weight | 567.74 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | 2-phenanthren-2-yl-4-phenyl-6-(9,9,10,10-tetramethylphenanthren-1-yl)-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccc5c(ccc6ccccc65)c4)n3)c2C1(C)C |
| InChI | InChI=1S/C41H33N3/c1-40(2)35-20-11-10-17-32(35)33-18-12-19-34(36(33)41(40,3)4)39-43-37(27-14-6-5-7-15-27)42-38(44-39)29-23-24-31-28(25-29)22-21-26-13-8-9-16-30(26)31/h5-25H,1-4H3 |
| InChIKey | TWNJTHQVMDZXCW-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.74 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|