C18H20N3+3 — CID 58150990
1-methyl-2,6-bis(1-methylpyridin-1-ium-2-yl)pyridin-1-ium (PubChem CID 58150990) has the molecular formula C18H20N3+3 and a molecular weight of 278.38 g/mol. Its IUPAC name is 1-methyl-2,6-bis(1-methylpyridin-1-ium-2-yl)pyridin-1-ium.
| Compound Name | 1-methyl-2,6-bis(1-methylpyridin-1-ium-2-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 58150990 |
| Molecular Formula | C18H20N3+3 |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 1-methyl-2,6-bis(1-methylpyridin-1-ium-2-yl)pyridin-1-ium |
| SMILES | C[n+]1ccccc1-c1cccc(-c2cccc[n+]2C)[n+]1C |
| InChI | InChI=1S/C18H20N3/c1-19-13-6-4-9-15(19)17-11-8-12-18(21(17)3)16-10-5-7-14-20(16)2/h4-14H,1-3H3/q+3 |
| InChIKey | MPMITJMXGHTLDV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 11.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|