C20H24N3O+3 — CID 169313124
4-(methoxymethyl)-1-methyl-2,6-bis(1-methylpyridin-1-ium-2-yl)pyridin-1-ium (PubChem CID 169313124) has the molecular formula C20H24N3O+3 and a molecular weight of 322.43 g/mol. Its IUPAC name is 4-(methoxymethyl)-1-methyl-2,6-bis(1-methylpyridin-1-ium-2-yl)pyridin-1-ium.
| Compound Name | 4-(methoxymethyl)-1-methyl-2,6-bis(1-methylpyridin-1-ium-2-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 169313124 |
| Molecular Formula | C20H24N3O+3 |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 4-(methoxymethyl)-1-methyl-2,6-bis(1-methylpyridin-1-ium-2-yl)pyridin-1-ium |
| SMILES | COCc1cc(-c2cccc[n+]2C)[n+](C)c(-c2cccc[n+]2C)c1 |
| InChI | InChI=1S/C20H24N3O/c1-21-11-7-5-9-17(21)19-13-16(15-24-4)14-20(23(19)3)18-10-6-8-12-22(18)2/h5-14H,15H2,1-4H3/q+3 |
| InChIKey | GCWSBRCJCYQNBF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 20.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|