C17H17N3+2 — CID 145493796
3,5-bis(1-methylpyridin-1-ium-2-yl)pyridine (PubChem CID 145493796) has the molecular formula C17H17N3+2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 3,5-bis(1-methylpyridin-1-ium-2-yl)pyridine.
| Compound Name | 3,5-bis(1-methylpyridin-1-ium-2-yl)pyridine |
|---|---|
| PubChem CID | 145493796 |
| Molecular Formula | C17H17N3+2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 3,5-bis(1-methylpyridin-1-ium-2-yl)pyridine |
| SMILES | C[n+]1ccccc1-c1cncc(-c2cccc[n+]2C)c1 |
| InChI | InChI=1S/C17H17N3/c1-19-9-5-3-7-16(19)14-11-15(13-18-12-14)17-8-4-6-10-20(17)2/h3-13H,1-2H3/q+2 |
| InChIKey | DMRIMDSEINBZDO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 20.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|