C25H21N3+2 — CID 21042169
N,N-dimethyl-6,6'-spirobi[pyrido[2,1-a]isoindol-5-ium]-9-amine (PubChem CID 21042169) has the molecular formula C25H21N3+2 and a molecular weight of 363.46 g/mol. Its IUPAC name is N,N-dimethyl-6,6'-spirobi[pyrido[2,1-a]isoindol-5-ium]-9-amine.
| Compound Name | N,N-dimethyl-6,6'-spirobi[pyrido[2,1-a]isoindol-5-ium]-9-amine |
|---|---|
| PubChem CID | 21042169 |
| Molecular Formula | C25H21N3+2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | N,N-dimethyl-6,6'-spirobi[pyrido[2,1-a]isoindol-5-ium]-9-amine |
| SMILES | CN(C)c1ccc2c(c1)-c1cccc[n+]1C21c2ccccc2-c2cccc[n+]21 |
| InChI | InChI=1S/C25H21N3/c1-26(2)18-13-14-22-20(17-18)24-12-6-8-16-28(24)25(22)21-10-4-3-9-19(21)23-11-5-7-15-27(23)25/h3-17H,1-2H3/q+2 |
| InChIKey | GYWKQZSRUUBORI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 11.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|