C40H34N2+2 — CID 167354490
5,7,13,15,18,18-hexamethylspiro[10-azoniahexacyclo[15.7.0.02,10.03,8.011,16.019,24]tetracosa-1(17),2(10),3,5,7,11,13,15,19,21,23-undecaene-9,6'-pyrido[2,1-a]isoindol-5-ium] (PubChem CID 167354490) has the molecular formula C40H34N2+2 and a molecular weight of 542.73 g/mol. Its IUPAC name is 5,7,13,15,18,18-hexamethylspiro[10-azoniahexacyclo[15.7.0.02,10.03,8.011,16.019,24]tetracosa-1(17),2(10),3,5,7,11,13,15,19,21,23-undecaene-9,6'-pyrido[2,1-a]isoindol-5-ium].
| Compound Name | 5,7,13,15,18,18-hexamethylspiro[10-azoniahexacyclo[15.7.0.02,10.03,8.011,16.019,24]tetracosa-1(17),2(10),3,5,7,11,13,15,19,21,23-undecaene-9,6'-pyrido[2,1-a]isoindol-5-ium] |
|---|---|
| PubChem CID | 167354490 |
| Molecular Formula | C40H34N2+2 |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | 5,7,13,15,18,18-hexamethylspiro[10-azoniahexacyclo[15.7.0.02,10.03,8.011,16.019,24]tetracosa-1(17),2(10),3,5,7,11,13,15,19,21,23-undecaene-9,6'-pyrido[2,1-a]isoindol-5-ium] |
| SMILES | Cc1cc(C)c2c(c1)-c1c3c(c4c(C)cc(C)cc4[n+]1C21c2ccccc2-c2cccc[n+]21)C(C)(C)c1ccccc1-3 |
| InChI | InChI=1S/C40H34N2/c1-23-20-26(4)36-29(21-23)38-35-28-14-8-9-15-30(28)39(5,6)37(35)34-25(3)19-24(2)22-33(34)42(38)40(36)31-16-10-7-13-27(31)32-17-11-12-18-41(32)40/h7-22H,1-6H3/q+2 |
| InChIKey | WEYITXOIAFWQKW-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|