C13H13N2+ — CID 123858590
6,11-dihydrobenzo[b]quinolizin-5-ium-6-amine (PubChem CID 123858590) has the molecular formula C13H13N2+ and a molecular weight of 197.26 g/mol. Its IUPAC name is 6,11-dihydrobenzo[b]quinolizin-5-ium-6-amine.
| Compound Name | 6,11-dihydrobenzo[b]quinolizin-5-ium-6-amine |
|---|---|
| PubChem CID | 123858590 |
| Molecular Formula | C13H13N2+ |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 6,11-dihydrobenzo[b]quinolizin-5-ium-6-amine |
| SMILES | NC1c2ccccc2Cc2cccc[n+]21 |
| InChI | InChI=1S/C13H13N2/c14-13-12-7-2-1-5-10(12)9-11-6-3-4-8-15(11)13/h1-8,13H,9,14H2/q+1 |
| InChIKey | RSTVJJSAGGUHMZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 29.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|