C9H10N2O — CID 58684839
(NZ)-N-(1-amino-1,3-dihydroinden-2-ylidene)hydroxylamine (PubChem CID 58684839) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is (NZ)-N-(1-amino-1,3-dihydroinden-2-ylidene)hydroxylamine.
| Compound Name | (NZ)-N-(1-amino-1,3-dihydroinden-2-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 58684839 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | (NZ)-N-(1-amino-1,3-dihydroinden-2-ylidene)hydroxylamine |
| SMILES | NC1/C(=N\O)Cc2ccccc21 |
| InChI | InChI=1S/C9H10N2O/c10-9-7-4-2-1-3-6(7)5-8(9)11-12/h1-4,9,12H,5,10H2/b11-8- |
| InChIKey | GGEBNHBSQOFOHU-FLIBITNWSA-N |
| XLogP | 1.07 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|