C20H23N3O2 — CID 5073866
N-[1-[4-(2-methoxyphenyl)piperazin-1-yl]-1,3-dihydroinden-2-ylidene]hydroxylamine (PubChem CID 5073866) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-[1-[4-(2-methoxyphenyl)piperazin-1-yl]-1,3-dihydroinden-2-ylidene]hydroxylamine.
| Compound Name | N-[1-[4-(2-methoxyphenyl)piperazin-1-yl]-1,3-dihydroinden-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 5073866 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-[1-[4-(2-methoxyphenyl)piperazin-1-yl]-1,3-dihydroinden-2-ylidene]hydroxylamine |
| SMILES | COc1ccccc1N1CCN(C2C(=NO)Cc3ccccc32)CC1 |
| InChI | InChI=1S/C20H23N3O2/c1-25-19-9-5-4-8-18(19)22-10-12-23(13-11-22)20-16-7-3-2-6-15(16)14-17(20)21-24/h2-9,20,24H,10-14H2,1H3 |
| InChIKey | GREUMLUNNGVTLB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 48.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|